C22H17Cl2N5O3 — CID 126063677
5-cyano-N-[(E)-(3,4-dichlorophenyl)methylideneamino]-1-(4-ethoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 126063677) has the molecular formula C22H17Cl2N5O3 and a molecular weight of 470.32 g/mol. Its IUPAC name is 5-cyano-N-[(E)-(3,4-dichlorophenyl)methylideneamino]-1-(4-ethoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | 5-cyano-N-[(E)-(3,4-dichlorophenyl)methylideneamino]-1-(4-ethoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 126063677 |
| Molecular Formula | C22H17Cl2N5O3 |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 5-cyano-N-[(E)-(3,4-dichlorophenyl)methylideneamino]-1-(4-ethoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | CCOc1ccc(-n2nc(C(=O)N/N=C/c3ccc(Cl)c(Cl)c3)c(C)c(C#N)c2=O)cc1 |
| InChI | InChI=1S/C22H17Cl2N5O3/c1-3-32-16-7-5-15(6-8-16)29-22(31)17(11-25)13(2)20(28-29)21(30)27-26-12-14-4-9-18(23)19(24)10-14/h4-10,12H,3H2,1-2H3,(H,27,30)/b26-12+ |
| InChIKey | JONXJQPUDBVVDB-RPPGKUMJSA-N |
| XLogP | 3.88 |
| TPSA | 109.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|