C23H20ClN5O4 — CID 135590133
1-(3-chloro-4-methylphenyl)-5-cyano-N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-4-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 135590133) has the molecular formula C23H20ClN5O4 and a molecular weight of 465.90 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-5-cyano-N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-4-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-(3-chloro-4-methylphenyl)-5-cyano-N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-4-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 135590133 |
| Molecular Formula | C23H20ClN5O4 |
| Molecular Weight | 465.90 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-5-cyano-N-[(E)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-4-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2nn(-c3ccc(C)c(Cl)c3)c(=O)c(C#N)c2C)ccc1O |
| InChI | InChI=1S/C23H20ClN5O4/c1-4-33-20-9-15(6-8-19(20)30)12-26-27-22(31)21-14(3)17(11-25)23(32)29(28-21)16-7-5-13(2)18(24)10-16/h5-10,12,30H,4H2,1-3H3,(H,27,31)/b26-12+ |
| InChIKey | XDYVFQHPQJUIEU-RPPGKUMJSA-N |
| XLogP | 3.24 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.90 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|