C22H17N5O4 — CID 126071603
4-[(E)-[[5-cyano-4-methyl-1-(4-methylphenyl)-6-oxopyridazine-3-carbonyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 126071603) has the molecular formula C22H17N5O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is 4-[(E)-[[5-cyano-4-methyl-1-(4-methylphenyl)-6-oxopyridazine-3-carbonyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[(E)-[[5-cyano-4-methyl-1-(4-methylphenyl)-6-oxopyridazine-3-carbonyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 126071603 |
| Molecular Formula | C22H17N5O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 4-[(E)-[[5-cyano-4-methyl-1-(4-methylphenyl)-6-oxopyridazine-3-carbonyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | Cc1ccc(-n2nc(C(=O)N/N=C/c3ccc(C(=O)O)cc3)c(C)c(C#N)c2=O)cc1 |
| InChI | InChI=1S/C22H17N5O4/c1-13-3-9-17(10-4-13)27-21(29)18(11-23)14(2)19(26-27)20(28)25-24-12-15-5-7-16(8-6-15)22(30)31/h3-10,12H,1-2H3,(H,25,28)(H,30,31)/b24-12+ |
| InChIKey | FDKRZEBZIBVUNK-WYMPLXKRSA-N |
| XLogP | 2.18 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|