C20H14N6O4 — CID 126077875
5-cyano-4-methyl-N-[(E)-(2-nitrophenyl)methylideneamino]-6-oxo-1-phenylpyridazine-3-carboxamide (PubChem CID 126077875) has the molecular formula C20H14N6O4 and a molecular weight of 402.37 g/mol. Its IUPAC name is 5-cyano-4-methyl-N-[(E)-(2-nitrophenyl)methylideneamino]-6-oxo-1-phenylpyridazine-3-carboxamide.
| Compound Name | 5-cyano-4-methyl-N-[(E)-(2-nitrophenyl)methylideneamino]-6-oxo-1-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 126077875 |
| Molecular Formula | C20H14N6O4 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 5-cyano-4-methyl-N-[(E)-(2-nitrophenyl)methylideneamino]-6-oxo-1-phenylpyridazine-3-carboxamide |
| SMILES | Cc1c(C(=O)N/N=C/c2ccccc2[N+](=O)[O-])nn(-c2ccccc2)c(=O)c1C#N |
| InChI | InChI=1S/C20H14N6O4/c1-13-16(11-21)20(28)25(15-8-3-2-4-9-15)24-18(13)19(27)23-22-12-14-7-5-6-10-17(14)26(29)30/h2-10,12H,1H3,(H,23,27)/b22-12+ |
| InChIKey | RWDHPRACUOVPCI-WSDLNYQXSA-N |
| XLogP | 2.08 |
| TPSA | 143.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|