C24H16ClN7O4 — CID 126073484
1-(4-chlorophenyl)-5-cyano-4-methyl-N-[(Z)-[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-6-oxopyridazine-3-carboxamide (PubChem CID 126073484) has the molecular formula C24H16ClN7O4 and a molecular weight of 501.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-cyano-4-methyl-N-[(Z)-[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-5-cyano-4-methyl-N-[(Z)-[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 126073484 |
| Molecular Formula | C24H16ClN7O4 |
| Molecular Weight | 501.89 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 1-(4-chlorophenyl)-5-cyano-4-methyl-N-[(Z)-[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-6-oxopyridazine-3-carboxamide |
| SMILES | Cc1c(C(=O)N/N=C\c2cccn2-c2ccc([N+](=O)[O-])cc2)nn(-c2ccc(Cl)cc2)c(=O)c1C#N |
| InChI | InChI=1S/C24H16ClN7O4/c1-15-21(13-26)24(34)31(18-6-4-16(25)5-7-18)29-22(15)23(33)28-27-14-20-3-2-12-30(20)17-8-10-19(11-9-17)32(35)36/h2-12,14H,1H3,(H,28,33)/b27-14- |
| InChIKey | JGCNJYVEZSCENB-VYYCAZPPSA-N |
| XLogP | 3.53 |
| TPSA | 148.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.89 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|