C28H18ClN5O2 — CID 40932509
N-[(E)-anthracen-9-ylmethylideneamino]-1-(4-chlorophenyl)-5-cyano-4-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 40932509) has the molecular formula C28H18ClN5O2 and a molecular weight of 491.94 g/mol. Its IUPAC name is N-[(E)-anthracen-9-ylmethylideneamino]-1-(4-chlorophenyl)-5-cyano-4-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[(E)-anthracen-9-ylmethylideneamino]-1-(4-chlorophenyl)-5-cyano-4-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 40932509 |
| Molecular Formula | C28H18ClN5O2 |
| Molecular Weight | 491.94 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | N-[(E)-anthracen-9-ylmethylideneamino]-1-(4-chlorophenyl)-5-cyano-4-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | Cc1c(C(=O)N/N=C/c2c3ccccc3cc3ccccc23)nn(-c2ccc(Cl)cc2)c(=O)c1C#N |
| InChI | InChI=1S/C28H18ClN5O2/c1-17-24(15-30)28(36)34(21-12-10-20(29)11-13-21)33-26(17)27(35)32-31-16-25-22-8-4-2-6-18(22)14-19-7-3-5-9-23(19)25/h2-14,16H,1H3,(H,32,35)/b31-16+ |
| InChIKey | DUEMVJRWKRAEOZ-WCMJOSRZSA-N |
| XLogP | 5.14 |
| TPSA | 100.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.94 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|