C25H19N5O4 — CID 135642987
5-cyano-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1-(4-methoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 135642987) has the molecular formula C25H19N5O4 and a molecular weight of 453.46 g/mol. Its IUPAC name is 5-cyano-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1-(4-methoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | 5-cyano-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1-(4-methoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 135642987 |
| Molecular Formula | C25H19N5O4 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 5-cyano-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-1-(4-methoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | COc1ccc(-n2nc(C(=O)N/N=C\c3c(O)ccc4ccccc34)c(C)c(C#N)c2=O)cc1 |
| InChI | InChI=1S/C25H19N5O4/c1-15-20(13-26)25(33)30(17-8-10-18(34-2)11-9-17)29-23(15)24(32)28-27-14-21-19-6-4-3-5-16(19)7-12-22(21)31/h3-12,14,31H,1-2H3,(H,28,32)/b27-14- |
| InChIKey | DPTZPAQANVNKCT-VYYCAZPPSA-N |
| XLogP | 3.04 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|