C26H21N5O2 — CID 126226679
5-cyano-1-(3,4-dimethylphenyl)-4-methyl-N-[(E)-naphthalen-1-ylmethylideneamino]-6-oxopyridazine-3-carboxamide (PubChem CID 126226679) has the molecular formula C26H21N5O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is 5-cyano-1-(3,4-dimethylphenyl)-4-methyl-N-[(E)-naphthalen-1-ylmethylideneamino]-6-oxopyridazine-3-carboxamide.
| Compound Name | 5-cyano-1-(3,4-dimethylphenyl)-4-methyl-N-[(E)-naphthalen-1-ylmethylideneamino]-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 126226679 |
| Molecular Formula | C26H21N5O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 5-cyano-1-(3,4-dimethylphenyl)-4-methyl-N-[(E)-naphthalen-1-ylmethylideneamino]-6-oxopyridazine-3-carboxamide |
| SMILES | Cc1ccc(-n2nc(C(=O)N/N=C/c3cccc4ccccc34)c(C)c(C#N)c2=O)cc1C |
| InChI | InChI=1S/C26H21N5O2/c1-16-11-12-21(13-17(16)2)31-26(33)23(14-27)18(3)24(30-31)25(32)29-28-15-20-9-6-8-19-7-4-5-10-22(19)20/h4-13,15H,1-3H3,(H,29,32)/b28-15+ |
| InChIKey | ALCYHJYHRYFDOD-RWPZCVJISA-N |
| XLogP | 3.95 |
| TPSA | 100.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|