C20H15ClN6O2 — CID 126066753
1-(3-chloro-4-methylphenyl)-5-cyano-4-methyl-6-oxo-N-[(Z)-pyridin-2-ylmethylideneamino]pyridazine-3-carboxamide (PubChem CID 126066753) has the molecular formula C20H15ClN6O2 and a molecular weight of 406.83 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-5-cyano-4-methyl-6-oxo-N-[(Z)-pyridin-2-ylmethylideneamino]pyridazine-3-carboxamide.
| Compound Name | 1-(3-chloro-4-methylphenyl)-5-cyano-4-methyl-6-oxo-N-[(Z)-pyridin-2-ylmethylideneamino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 126066753 |
| Molecular Formula | C20H15ClN6O2 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-5-cyano-4-methyl-6-oxo-N-[(Z)-pyridin-2-ylmethylideneamino]pyridazine-3-carboxamide |
| SMILES | Cc1ccc(-n2nc(C(=O)N/N=C\c3ccccn3)c(C)c(C#N)c2=O)cc1Cl |
| InChI | InChI=1S/C20H15ClN6O2/c1-12-6-7-15(9-17(12)21)27-20(29)16(10-22)13(2)18(26-27)19(28)25-24-11-14-5-3-4-8-23-14/h3-9,11H,1-2H3,(H,25,28)/b24-11- |
| InChIKey | QYMJCLUOBYWHAA-MYKKPKGFSA-N |
| XLogP | 2.53 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|