C22H18ClN5O3 — CID 126067039
N-[(E)-(2-chlorophenyl)methylideneamino]-5-cyano-1-(4-ethoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 126067039) has the molecular formula C22H18ClN5O3 and a molecular weight of 435.87 g/mol. Its IUPAC name is N-[(E)-(2-chlorophenyl)methylideneamino]-5-cyano-1-(4-ethoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[(E)-(2-chlorophenyl)methylideneamino]-5-cyano-1-(4-ethoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 126067039 |
| Molecular Formula | C22H18ClN5O3 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-[(E)-(2-chlorophenyl)methylideneamino]-5-cyano-1-(4-ethoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | CCOc1ccc(-n2nc(C(=O)N/N=C/c3ccccc3Cl)c(C)c(C#N)c2=O)cc1 |
| InChI | InChI=1S/C22H18ClN5O3/c1-3-31-17-10-8-16(9-11-17)28-22(30)18(12-24)14(2)20(27-28)21(29)26-25-13-15-6-4-5-7-19(15)23/h4-11,13H,3H2,1-2H3,(H,26,29)/b25-13+ |
| InChIKey | SAXJASVXPLWKLZ-DHRITJCHSA-N |
| XLogP | 3.23 |
| TPSA | 109.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|