C22H18ClN5O4 — CID 126064863
1-(4-chlorophenyl)-5-cyano-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-4-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 126064863) has the molecular formula C22H18ClN5O4 and a molecular weight of 451.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-cyano-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-4-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-5-cyano-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-4-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 126064863 |
| Molecular Formula | C22H18ClN5O4 |
| Molecular Weight | 451.87 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 1-(4-chlorophenyl)-5-cyano-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]-4-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2nn(-c3ccc(Cl)cc3)c(=O)c(C#N)c2C)c(OC)c1 |
| InChI | InChI=1S/C22H18ClN5O4/c1-13-18(11-24)22(30)28(16-7-5-15(23)6-8-16)27-20(13)21(29)26-25-12-14-4-9-17(31-2)10-19(14)32-3/h4-10,12H,1-3H3,(H,26,29)/b25-12+ |
| InChIKey | OXPHZNWUCFEQTL-BRJLIKDPSA-N |
| XLogP | 2.85 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.87 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|