C21H16FN5O3 — CID 126058810
5-cyano-N-[(E)-(4-fluorophenyl)methylideneamino]-1-(4-methoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 126058810) has the molecular formula C21H16FN5O3 and a molecular weight of 405.39 g/mol. Its IUPAC name is 5-cyano-N-[(E)-(4-fluorophenyl)methylideneamino]-1-(4-methoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | 5-cyano-N-[(E)-(4-fluorophenyl)methylideneamino]-1-(4-methoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 126058810 |
| Molecular Formula | C21H16FN5O3 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 5-cyano-N-[(E)-(4-fluorophenyl)methylideneamino]-1-(4-methoxyphenyl)-4-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | COc1ccc(-n2nc(C(=O)N/N=C/c3ccc(F)cc3)c(C)c(C#N)c2=O)cc1 |
| InChI | InChI=1S/C21H16FN5O3/c1-13-18(11-23)21(29)27(16-7-9-17(30-2)10-8-16)26-19(13)20(28)25-24-12-14-3-5-15(22)6-4-14/h3-10,12H,1-2H3,(H,25,28)/b24-12+ |
| InChIKey | DPEIYEGMDQUMFL-WYMPLXKRSA-N |
| XLogP | 2.32 |
| TPSA | 109.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|