C24H24N6O2 — CID 126068454
5-cyano-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1-(4-ethylphenyl)-4-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 126068454) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 5-cyano-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1-(4-ethylphenyl)-4-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | 5-cyano-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1-(4-ethylphenyl)-4-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 126068454 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 5-cyano-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-1-(4-ethylphenyl)-4-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | CCc1ccc(-n2nc(C(=O)N/N=C/c3ccc(N(C)C)cc3)c(C)c(C#N)c2=O)cc1 |
| InChI | InChI=1S/C24H24N6O2/c1-5-17-6-12-20(13-7-17)30-24(32)21(14-25)16(2)22(28-30)23(31)27-26-15-18-8-10-19(11-9-18)29(3)4/h6-13,15H,5H2,1-4H3,(H,27,31)/b26-15+ |
| InChIKey | MWMIEVRJEYUZDG-CVKSISIWSA-N |
| XLogP | 2.80 |
| TPSA | 103.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|