C30H23N5O2 — CID 126068764
N-[(E)-anthracen-9-ylmethylideneamino]-5-cyano-1-(4-ethylphenyl)-4-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 126068764) has the molecular formula C30H23N5O2 and a molecular weight of 485.55 g/mol. Its IUPAC name is N-[(E)-anthracen-9-ylmethylideneamino]-5-cyano-1-(4-ethylphenyl)-4-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[(E)-anthracen-9-ylmethylideneamino]-5-cyano-1-(4-ethylphenyl)-4-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 126068764 |
| Molecular Formula | C30H23N5O2 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | N-[(E)-anthracen-9-ylmethylideneamino]-5-cyano-1-(4-ethylphenyl)-4-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | CCc1ccc(-n2nc(C(=O)N/N=C/c3c4ccccc4cc4ccccc34)c(C)c(C#N)c2=O)cc1 |
| InChI | InChI=1S/C30H23N5O2/c1-3-20-12-14-23(15-13-20)35-30(37)26(17-31)19(2)28(34-35)29(36)33-32-18-27-24-10-6-4-8-21(24)16-22-9-5-7-11-25(22)27/h4-16,18H,3H2,1-2H3,(H,33,36)/b32-18+ |
| InChIKey | SSYUEVKQRFDGNW-KCSSXMTESA-N |
| XLogP | 5.05 |
| TPSA | 100.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|