C18H16ClN5O2S — CID 136764624
2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 136764624) has the molecular formula C18H16ClN5O2S and a molecular weight of 401.88 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136764624 |
| Molecular Formula | C18H16ClN5O2S |
| Molecular Weight | 401.88 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | Cn1c(SCC(=O)N/N=C\c2ccc(O)cc2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN5O2S/c1-24-17(13-4-6-14(19)7-5-13)22-23-18(24)27-11-16(26)21-20-10-12-2-8-15(25)9-3-12/h2-10,25H,11H2,1H3,(H,21,26)/b20-10- |
| InChIKey | OAZVMTWQCXLCES-JMIUGGIZSA-N |
| XLogP | 3.08 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.88 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|