C18H16ClN5O3S — CID 135613134
2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]acetamide (PubChem CID 135613134) has the molecular formula C18H16ClN5O3S and a molecular weight of 417.88 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135613134 |
| Molecular Formula | C18H16ClN5O3S |
| Molecular Weight | 417.88 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]acetamide |
| SMILES | Cn1c(SCC(=O)N/N=C/c2ccc(O)cc2O)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN5O3S/c1-24-17(11-2-5-13(19)6-3-11)22-23-18(24)28-10-16(27)21-20-9-12-4-7-14(25)8-15(12)26/h2-9,25-26H,10H2,1H3,(H,21,27)/b20-9+ |
| InChIKey | NGXRFCGMZPRNKZ-AWQFTUOYSA-N |
| XLogP | 2.79 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.88 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|