C23H17Cl2N5O2S — CID 135716255
2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135716255) has the molecular formula C23H17Cl2N5O2S and a molecular weight of 498.40 g/mol. Its IUPAC name is 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135716255 |
| Molecular Formula | C23H17Cl2N5O2S |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C23H17Cl2N5O2S/c24-17-7-5-15(6-8-17)22-28-29-23(30(22)19-11-9-18(25)10-12-19)33-14-21(32)27-26-13-16-3-1-2-4-20(16)31/h1-13,31H,14H2,(H,27,32)/b26-13+ |
| InChIKey | YAZVDTPNWCDZCZ-LGJNPRDNSA-N |
| XLogP | 5.19 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|