C23H15Br2Cl2N5O2S — CID 5225715
2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 5225715) has the molecular formula C23H15Br2Cl2N5O2S and a molecular weight of 656.19 g/mol. Its IUPAC name is 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5225715 |
| Molecular Formula | C23H15Br2Cl2N5O2S |
| Molecular Weight | 656.19 g/mol |
| Exact Mass | 652.87 |
| IUPAC Name | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1)NN=Cc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C23H15Br2Cl2N5O2S/c24-15-9-14(21(34)19(25)10-15)11-28-29-20(33)12-35-23-31-30-22(13-1-3-16(26)4-2-13)32(23)18-7-5-17(27)6-8-18/h1-11,34H,12H2,(H,29,33) |
| InChIKey | SDNYJCQGURNZCQ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.19 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|