C22H15Br2ClN6O2S — CID 135716450
2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135716450) has the molecular formula C22H15Br2ClN6O2S and a molecular weight of 622.73 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135716450 |
| Molecular Formula | C22H15Br2ClN6O2S |
| Molecular Weight | 622.73 g/mol |
| Exact Mass | 619.90 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccncc2)n1-c1ccc(Cl)cc1)N/N=C/c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C22H15Br2ClN6O2S/c23-15-9-14(20(33)18(24)10-15)11-27-28-19(32)12-34-22-30-29-21(13-5-7-26-8-6-13)31(22)17-3-1-16(25)2-4-17/h1-11,33H,12H2,(H,28,32)/b27-11+ |
| InChIKey | RFGGDHDTWFVHTD-LUOAPIJWSA-N |
| XLogP | 5.46 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.73 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|