C26H19ClN6O2S — CID 136886949
2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide (PubChem CID 136886949) has the molecular formula C26H19ClN6O2S and a molecular weight of 515.00 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136886949 |
| Molecular Formula | C26H19ClN6O2S |
| Molecular Weight | 515.00 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccncc2)n1-c1ccc(Cl)cc1)N/N=C\c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C26H19ClN6O2S/c27-19-6-8-20(9-7-19)33-25(18-11-13-28-14-12-18)31-32-26(33)36-16-24(35)30-29-15-22-21-4-2-1-3-17(21)5-10-23(22)34/h1-15,34H,16H2,(H,30,35)/b29-15- |
| InChIKey | GLFKVCMLMBQESL-FDVSRXAVSA-N |
| XLogP | 5.08 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.00 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|