C27H20BrN5O2S — CID 4510287
2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide (PubChem CID 4510287) has the molecular formula C27H20BrN5O2S and a molecular weight of 558.46 g/mol. Its IUPAC name is 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide.
| Compound Name | 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4510287 |
| Molecular Formula | C27H20BrN5O2S |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 557.05 |
| IUPAC Name | 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccc2)n1-c1ccc(Br)cc1)NN=Cc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C27H20BrN5O2S/c28-20-11-13-21(14-12-20)33-26(19-7-2-1-3-8-19)31-32-27(33)36-17-25(35)30-29-16-23-22-9-5-4-6-18(22)10-15-24(23)34/h1-16,34H,17H2,(H,30,35) |
| InChIKey | FOJIYYFPTXDQNC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|