C29H25N5O3S — CID 6879793
N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 6879793) has the molecular formula C29H25N5O3S and a molecular weight of 523.62 g/mol. Its IUPAC name is N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6879793 |
| Molecular Formula | C29H25N5O3S |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-2-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(-n2c(SCC(=O)N/N=C/c3c(OC)ccc4ccccc34)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25N5O3S/c1-36-23-15-13-22(14-16-23)34-28(21-9-4-3-5-10-21)32-33-29(34)38-19-27(35)31-30-18-25-24-11-7-6-8-20(24)12-17-26(25)37-2/h3-18H,19H2,1-2H3,(H,31,35)/b30-18+ |
| InChIKey | MKNPHEVHVOYLPD-UXHLAJHPSA-N |
| XLogP | 5.35 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|