C21H16BrN5OS2 — CID 1417493
2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(thiophen-2-ylmethylideneamino)acetamide (PubChem CID 1417493) has the molecular formula C21H16BrN5OS2 and a molecular weight of 498.43 g/mol. Its IUPAC name is 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(thiophen-2-ylmethylideneamino)acetamide.
| Compound Name | 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(thiophen-2-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 1417493 |
| Molecular Formula | C21H16BrN5OS2 |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 497.00 |
| IUPAC Name | 2-[[4-(4-bromophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(thiophen-2-ylmethylideneamino)acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccc2)n1-c1ccc(Br)cc1)NN=Cc1cccs1 |
| InChI | InChI=1S/C21H16BrN5OS2/c22-16-8-10-17(11-9-16)27-20(15-5-2-1-3-6-15)25-26-21(27)30-14-19(28)24-23-13-18-7-4-12-29-18/h1-13H,14H2,(H,24,28) |
| InChIKey | AUIDUKIATZTRTG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|