C23H17Cl2N5O3S — CID 135642108
2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]acetamide (PubChem CID 135642108) has the molecular formula C23H17Cl2N5O3S and a molecular weight of 514.39 g/mol. Its IUPAC name is 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135642108 |
| Molecular Formula | C23H17Cl2N5O3S |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccc(Cl)cc1)N/N=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C23H17Cl2N5O3S/c24-16-4-2-15(3-5-16)22-28-29-23(30(22)18-8-6-17(25)7-9-18)34-13-21(33)27-26-12-14-1-10-19(31)20(32)11-14/h1-12,31-32H,13H2,(H,27,33)/b26-12+ |
| InChIKey | MQZAFSSKBUWYSP-RPPGKUMJSA-N |
| XLogP | 4.89 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|