C25H20ClI2N5O3S — CID 4007515
2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide (PubChem CID 4007515) has the molecular formula C25H20ClI2N5O3S and a molecular weight of 759.79 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4007515 |
| Molecular Formula | C25H20ClI2N5O3S |
| Molecular Weight | 759.79 g/mol |
| Exact Mass | 758.91 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)NN=Cc3cc(I)cc(I)c3O)nnc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H20ClI2N5O3S/c1-2-36-20-9-7-19(8-10-20)33-24(15-3-5-17(26)6-4-15)31-32-25(33)37-14-22(34)30-29-13-16-11-18(27)12-21(28)23(16)35/h3-13,35H,2,14H2,1H3,(H,30,34) |
| InChIKey | LEZDKLQLURUFDW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.79 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|