C27H25I2N5O2S — CID 136754454
2-[[5-(4-tert-butylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide (PubChem CID 136754454) has the molecular formula C27H25I2N5O2S and a molecular weight of 737.40 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-tert-butylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136754454 |
| Molecular Formula | C27H25I2N5O2S |
| Molecular Weight | 737.40 g/mol |
| Exact Mass | 736.98 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide |
| SMILES | CC(C)(C)c1ccc(-c2nnc(SCC(=O)N/N=C\c3cc(I)cc(I)c3O)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25I2N5O2S/c1-27(2,3)19-11-9-17(10-12-19)25-32-33-26(34(25)21-7-5-4-6-8-21)37-16-23(35)31-30-15-18-13-20(28)14-22(29)24(18)36/h4-15,36H,16H2,1-3H3,(H,31,35)/b30-15- |
| InChIKey | DXTTZOARWJODSF-MNDYBZJGSA-N |
| XLogP | 6.39 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.40 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|