C24H19I2N5O3S — CID 136715869
N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-2-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 136715869) has the molecular formula C24H19I2N5O3S and a molecular weight of 711.32 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-2-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-2-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 136715869 |
| Molecular Formula | C24H19I2N5O3S |
| Molecular Weight | 711.32 g/mol |
| Exact Mass | 710.93 |
| IUPAC Name | N-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-2-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(-n2c(SCC(=O)N/N=C\c3cc(I)cc(I)c3O)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H19I2N5O3S/c1-34-19-9-7-18(8-10-19)31-23(15-5-3-2-4-6-15)29-30-24(31)35-14-21(32)28-27-13-16-11-17(25)12-20(26)22(16)33/h2-13,33H,14H2,1H3,(H,28,32)/b27-13- |
| InChIKey | RFRASOLTBGCAKL-WKIKZPBSSA-N |
| XLogP | 5.10 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.32 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|