C25H21Cl2N5O2S — CID 6867048
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 6867048) has the molecular formula C25H21Cl2N5O2S and a molecular weight of 526.45 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6867048 |
| Molecular Formula | C25H21Cl2N5O2S |
| Molecular Weight | 526.45 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)N/N=C/c3ccc(Cl)cc3Cl)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21Cl2N5O2S/c1-2-34-21-12-10-20(11-13-21)32-24(17-6-4-3-5-7-17)30-31-25(32)35-16-23(33)29-28-15-18-8-9-19(26)14-22(18)27/h3-15H,2,16H2,1H3,(H,29,33)/b28-15+ |
| InChIKey | DAVDBTXHOFPETR-RWPZCVJISA-N |
| XLogP | 5.88 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.45 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|