C27H24N6O2S — CID 1390818
2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1H-indol-3-ylmethylideneamino)acetamide (PubChem CID 1390818) has the molecular formula C27H24N6O2S and a molecular weight of 496.60 g/mol. Its IUPAC name is 2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1H-indol-3-ylmethylideneamino)acetamide.
| Compound Name | 2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1H-indol-3-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 1390818 |
| Molecular Formula | C27H24N6O2S |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1H-indol-3-ylmethylideneamino)acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)NN=Cc3c[nH]c4ccccc34)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H24N6O2S/c1-2-35-22-14-12-21(13-15-22)33-26(19-8-4-3-5-9-19)31-32-27(33)36-18-25(34)30-29-17-20-16-28-24-11-7-6-10-23(20)24/h3-17,28H,2,18H2,1H3,(H,30,34) |
| InChIKey | WUKZUXQQBCAJDS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|