C21H20N6OS — CID 135544922
2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(E)-1H-indol-3-ylmethylideneamino]acetamide (PubChem CID 135544922) has the molecular formula C21H20N6OS and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(E)-1H-indol-3-ylmethylideneamino]acetamide.
| Compound Name | 2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(E)-1H-indol-3-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 135544922 |
| Molecular Formula | C21H20N6OS |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(E)-1H-indol-3-ylmethylideneamino]acetamide |
| SMILES | CCn1c(SCC(=O)N/N=C/c2c[nH]c3ccccc23)nnc1-c1ccccc1 |
| InChI | InChI=1S/C21H20N6OS/c1-2-27-20(15-8-4-3-5-9-15)25-26-21(27)29-14-19(28)24-23-13-16-12-22-18-11-7-6-10-17(16)18/h3-13,22H,2,14H2,1H3,(H,24,28)/b23-13+ |
| InChIKey | UAWZPZBUWXYQOF-YDZHTSKRSA-N |
| XLogP | 3.69 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|