C33H39N5O3S — CID 3419860
N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3419860) has the molecular formula C33H39N5O3S and a molecular weight of 585.77 g/mol. Its IUPAC name is N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3419860 |
| Molecular Formula | C33H39N5O3S |
| Molecular Weight | 585.77 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[[4-(4-ethoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)NN=Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H39N5O3S/c1-8-41-25-16-14-24(15-17-25)38-30(23-12-10-9-11-13-23)36-37-31(38)42-21-28(39)35-34-20-22-18-26(32(2,3)4)29(40)27(19-22)33(5,6)7/h9-20,40H,8,21H2,1-7H3,(H,35,39) |
| InChIKey | QWHYSAJUZDFSGV-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.77 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|