C28H28ClN5O5S — CID 6072385
2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 6072385) has the molecular formula C28H28ClN5O5S and a molecular weight of 582.08 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6072385 |
| Molecular Formula | C28H28ClN5O5S |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)N/N=C\c3ccc(OC)c(OC)c3OC)nnc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H28ClN5O5S/c1-5-39-22-13-11-21(12-14-22)34-27(18-6-9-20(29)10-7-18)32-33-28(34)40-17-24(35)31-30-16-19-8-15-23(36-2)26(38-4)25(19)37-3/h6-16H,5,17H2,1-4H3,(H,31,35)/b30-16- |
| InChIKey | JAMUDSSDWGJNMM-UHBFCERESA-N |
| XLogP | 5.25 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|