C26H23BrClN5O3S — CID 3971642
N-[(3-bromo-4-methoxyphenyl)methylideneamino]-2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3971642) has the molecular formula C26H23BrClN5O3S and a molecular weight of 600.93 g/mol. Its IUPAC name is N-[(3-bromo-4-methoxyphenyl)methylideneamino]-2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(3-bromo-4-methoxyphenyl)methylideneamino]-2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3971642 |
| Molecular Formula | C26H23BrClN5O3S |
| Molecular Weight | 600.93 g/mol |
| Exact Mass | 599.04 |
| IUPAC Name | N-[(3-bromo-4-methoxyphenyl)methylideneamino]-2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)NN=Cc3ccc(OC)c(Br)c3)nnc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H23BrClN5O3S/c1-3-36-21-11-9-20(10-12-21)33-25(18-5-7-19(28)8-6-18)31-32-26(33)37-16-24(34)30-29-15-17-4-13-23(35-2)22(27)14-17/h4-15H,3,16H2,1-2H3,(H,30,34) |
| InChIKey | PQLSGEMZJZIRFH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.93 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|