C25H21BrClN5O3S — CID 6893694
N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-[[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 6893694) has the molecular formula C25H21BrClN5O3S and a molecular weight of 586.90 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-[[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-[[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6893694 |
| Molecular Formula | C25H21BrClN5O3S |
| Molecular Weight | 586.90 g/mol |
| Exact Mass | 585.02 |
| IUPAC Name | N-[(E)-(3-bromo-4-methoxyphenyl)methylideneamino]-2-[[4-(4-chlorophenyl)-5-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(-c2nnc(SCC(=O)N/N=C/c3ccc(OC)c(Br)c3)n2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H21BrClN5O3S/c1-34-20-10-4-17(5-11-20)24-30-31-25(32(24)19-8-6-18(27)7-9-19)36-15-23(33)29-28-14-16-3-12-22(35-2)21(26)13-16/h3-14H,15H2,1-2H3,(H,29,33)/b28-14+ |
| InChIKey | OWTQUWREMXQXCE-CCVNUDIWSA-N |
| XLogP | 5.61 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.90 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|