C27H26ClN5O4S — CID 6868551
2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide (PubChem CID 6868551) has the molecular formula C27H26ClN5O4S and a molecular weight of 552.06 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6868551 |
| Molecular Formula | C27H26ClN5O4S |
| Molecular Weight | 552.06 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-(4-ethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)N/N=C/c3ccc(OC)cc3OC)nnc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H26ClN5O4S/c1-4-37-22-13-10-21(11-14-22)33-26(18-5-8-20(28)9-6-18)31-32-27(33)38-17-25(34)30-29-16-19-7-12-23(35-2)15-24(19)36-3/h5-16H,4,17H2,1-3H3,(H,30,34)/b29-16+ |
| InChIKey | ZQPUXLQVGAIART-MUFRIFMGSA-N |
| XLogP | 5.25 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.06 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|