C19H16ClI2N5O2S — CID 4508803
2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide (PubChem CID 4508803) has the molecular formula C19H16ClI2N5O2S and a molecular weight of 667.70 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4508803 |
| Molecular Formula | C19H16ClI2N5O2S |
| Molecular Weight | 667.70 g/mol |
| Exact Mass | 666.88 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]acetamide |
| SMILES | CCn1c(SCC(=O)NN=Cc2cc(I)cc(I)c2O)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClI2N5O2S/c1-2-27-18(11-3-5-13(20)6-4-11)25-26-19(27)30-10-16(28)24-23-9-12-7-14(21)8-15(22)17(12)29/h3-9,29H,2,10H2,1H3,(H,24,28) |
| InChIKey | PALKIJHEZAUNEW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|