C19H18ClN5OS — CID 1282666
2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methylphenyl)methylideneamino]acetamide (PubChem CID 1282666) has the molecular formula C19H18ClN5OS and a molecular weight of 399.91 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methylphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 1282666 |
| Molecular Formula | C19H18ClN5OS |
| Molecular Weight | 399.91 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methylphenyl)methylideneamino]acetamide |
| SMILES | Cc1ccccc1C=NNC(=O)CSc1nnc(-c2ccc(Cl)cc2)n1C |
| InChI | InChI=1S/C19H18ClN5OS/c1-13-5-3-4-6-15(13)11-21-22-17(26)12-27-19-24-23-18(25(19)2)14-7-9-16(20)10-8-14/h3-11H,12H2,1-2H3,(H,22,26) |
| InChIKey | QVQXSYMMKOGFMW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.91 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|