C31H33Cl3N2O — CID 163534916
N-[3-(2-adamantyl)propyl]-1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-4-methylpyrrole-3-carboxamide (PubChem CID 163534916) has the molecular formula C31H33Cl3N2O and a molecular weight of 555.98 g/mol. Its IUPAC name is N-[3-(2-adamantyl)propyl]-1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-4-methylpyrrole-3-carboxamide.
| Compound Name | N-[3-(2-adamantyl)propyl]-1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-4-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 163534916 |
| Molecular Formula | C31H33Cl3N2O |
| Molecular Weight | 555.98 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | N-[3-(2-adamantyl)propyl]-1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-4-methylpyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCCC2C3CC4CC(C3)CC2C4)cn(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H33Cl3N2O/c1-18-28(31(37)35-10-2-3-26-21-12-19-11-20(14-21)15-22(26)13-19)17-36(25-7-4-23(32)5-8-25)30(18)27-9-6-24(33)16-29(27)34/h4-9,16-17,19-22,26H,2-3,10-15H2,1H3,(H,35,37) |
| InChIKey | DWCUGLGZPJIZJF-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.98 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|