C25H23ClFN5O7S — CID 121249272
4-[4-[2-(2-chloro-4-fluorophenyl)-5-[(1,1-dioxo-1,4-thiazinan-4-yl)carbamoyl]-4-methoxypyrazol-3-yl]phenyl]but-3-ynyl nitrate (PubChem CID 121249272) has the molecular formula C25H23ClFN5O7S and a molecular weight of 592.01 g/mol. Its IUPAC name is 4-[4-[2-(2-chloro-4-fluorophenyl)-5-[(1,1-dioxo-1,4-thiazinan-4-yl)carbamoyl]-4-methoxypyrazol-3-yl]phenyl]but-3-ynyl nitrate.
| Compound Name | 4-[4-[2-(2-chloro-4-fluorophenyl)-5-[(1,1-dioxo-1,4-thiazinan-4-yl)carbamoyl]-4-methoxypyrazol-3-yl]phenyl]but-3-ynyl nitrate |
|---|---|
| PubChem CID | 121249272 |
| Molecular Formula | C25H23ClFN5O7S |
| Molecular Weight | 592.01 g/mol |
| Exact Mass | 591.10 |
| IUPAC Name | 4-[4-[2-(2-chloro-4-fluorophenyl)-5-[(1,1-dioxo-1,4-thiazinan-4-yl)carbamoyl]-4-methoxypyrazol-3-yl]phenyl]but-3-ynyl nitrate |
| SMILES | COc1c(C(=O)NN2CCS(=O)(=O)CC2)nn(-c2ccc(F)cc2Cl)c1-c1ccc(C#CCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H23ClFN5O7S/c1-38-24-22(25(33)29-30-11-14-40(36,37)15-12-30)28-31(21-10-9-19(27)16-20(21)26)23(24)18-7-5-17(6-8-18)4-2-3-13-39-32(34)35/h5-10,16H,3,11-15H2,1H3,(H,29,33) |
| InChIKey | XBYCWTWLRYZPKK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 145.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.01 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|