C24H24Cl2N4O3 — CID 162713247
[4-[1-(2,4-dichlorophenyl)-4-ethyl-3-(piperidin-1-ylcarbamoyl)pyrazol-5-yl]phenyl] formate (PubChem CID 162713247) has the molecular formula C24H24Cl2N4O3 and a molecular weight of 487.39 g/mol. Its IUPAC name is [4-[1-(2,4-dichlorophenyl)-4-ethyl-3-(piperidin-1-ylcarbamoyl)pyrazol-5-yl]phenyl] formate.
| Compound Name | [4-[1-(2,4-dichlorophenyl)-4-ethyl-3-(piperidin-1-ylcarbamoyl)pyrazol-5-yl]phenyl] formate |
|---|---|
| PubChem CID | 162713247 |
| Molecular Formula | C24H24Cl2N4O3 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | [4-[1-(2,4-dichlorophenyl)-4-ethyl-3-(piperidin-1-ylcarbamoyl)pyrazol-5-yl]phenyl] formate |
| SMILES | CCc1c(C(=O)NN2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(OC=O)cc1 |
| InChI | InChI=1S/C24H24Cl2N4O3/c1-2-19-22(24(32)28-29-12-4-3-5-13-29)27-30(21-11-8-17(25)14-20(21)26)23(19)16-6-9-18(10-7-16)33-15-31/h6-11,14-15H,2-5,12-13H2,1H3,(H,28,32) |
| InChIKey | AZVFLFMIWPEWJC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|