C21H12Cl2F2N2 — CID 19587147
4-chloro-1-(2-chlorophenyl)-3,5-bis(4-fluorophenyl)pyrazole (PubChem CID 19587147) has the molecular formula C21H12Cl2F2N2 and a molecular weight of 401.24 g/mol. Its IUPAC name is 4-chloro-1-(2-chlorophenyl)-3,5-bis(4-fluorophenyl)pyrazole.
| Compound Name | 4-chloro-1-(2-chlorophenyl)-3,5-bis(4-fluorophenyl)pyrazole |
|---|---|
| PubChem CID | 19587147 |
| Molecular Formula | C21H12Cl2F2N2 |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 4-chloro-1-(2-chlorophenyl)-3,5-bis(4-fluorophenyl)pyrazole |
| SMILES | Fc1ccc(-c2nn(-c3ccccc3Cl)c(-c3ccc(F)cc3)c2Cl)cc1 |
| InChI | InChI=1S/C21H12Cl2F2N2/c22-17-3-1-2-4-18(17)27-21(14-7-11-16(25)12-8-14)19(23)20(26-27)13-5-9-15(24)10-6-13/h1-12H |
| InChIKey | JXUYOZYDPGVXRZ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |