C24H21ClN2 — CID 19587079
4-chloro-3,5-bis(3-methylphenyl)-1-(4-methylphenyl)pyrazole (PubChem CID 19587079) has the molecular formula C24H21ClN2 and a molecular weight of 372.90 g/mol. Its IUPAC name is 4-chloro-3,5-bis(3-methylphenyl)-1-(4-methylphenyl)pyrazole.
| Compound Name | 4-chloro-3,5-bis(3-methylphenyl)-1-(4-methylphenyl)pyrazole |
|---|---|
| PubChem CID | 19587079 |
| Molecular Formula | C24H21ClN2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 4-chloro-3,5-bis(3-methylphenyl)-1-(4-methylphenyl)pyrazole |
| SMILES | Cc1ccc(-n2nc(-c3cccc(C)c3)c(Cl)c2-c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C24H21ClN2/c1-16-10-12-21(13-11-16)27-24(20-9-5-7-18(3)15-20)22(25)23(26-27)19-8-4-6-17(2)14-19/h4-15H,1-3H3 |
| InChIKey | MCBBHLYWEYKKLO-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |