C23H17Cl3N2 — CID 19587037
4-chloro-1-(3,5-dichlorophenyl)-3,5-bis(4-methylphenyl)pyrazole (PubChem CID 19587037) has the molecular formula C23H17Cl3N2 and a molecular weight of 427.76 g/mol. Its IUPAC name is 4-chloro-1-(3,5-dichlorophenyl)-3,5-bis(4-methylphenyl)pyrazole.
| Compound Name | 4-chloro-1-(3,5-dichlorophenyl)-3,5-bis(4-methylphenyl)pyrazole |
|---|---|
| PubChem CID | 19587037 |
| Molecular Formula | C23H17Cl3N2 |
| Molecular Weight | 427.76 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 4-chloro-1-(3,5-dichlorophenyl)-3,5-bis(4-methylphenyl)pyrazole |
| SMILES | Cc1ccc(-c2nn(-c3cc(Cl)cc(Cl)c3)c(-c3ccc(C)cc3)c2Cl)cc1 |
| InChI | InChI=1S/C23H17Cl3N2/c1-14-3-7-16(8-4-14)22-21(26)23(17-9-5-15(2)6-10-17)28(27-22)20-12-18(24)11-19(25)13-20/h3-13H,1-2H3 |
| InChIKey | GALAVELESONVFE-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.76 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |