C21H12Br2Cl2N2 — CID 17025660
3,5-bis(4-bromophenyl)-4-chloro-1-(3-chlorophenyl)pyrazole (PubChem CID 17025660) has the molecular formula C21H12Br2Cl2N2 and a molecular weight of 523.06 g/mol. Its IUPAC name is 3,5-bis(4-bromophenyl)-4-chloro-1-(3-chlorophenyl)pyrazole.
| Compound Name | 3,5-bis(4-bromophenyl)-4-chloro-1-(3-chlorophenyl)pyrazole |
|---|---|
| PubChem CID | 17025660 |
| Molecular Formula | C21H12Br2Cl2N2 |
| Molecular Weight | 523.06 g/mol |
| Exact Mass | 519.87 |
| IUPAC Name | 3,5-bis(4-bromophenyl)-4-chloro-1-(3-chlorophenyl)pyrazole |
| SMILES | Clc1cccc(-n2nc(-c3ccc(Br)cc3)c(Cl)c2-c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C21H12Br2Cl2N2/c22-15-8-4-13(5-9-15)20-19(25)21(14-6-10-16(23)11-7-14)27(26-20)18-3-1-2-17(24)12-18/h1-12H |
| InChIKey | ANYYHZJXSWGZLT-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.06 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |