C25H24N2O2 — CID 19587307
3,5-bis(3-methoxyphenyl)-4-methyl-1-(4-methylphenyl)pyrazole (PubChem CID 19587307) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3,5-bis(3-methoxyphenyl)-4-methyl-1-(4-methylphenyl)pyrazole.
| Compound Name | 3,5-bis(3-methoxyphenyl)-4-methyl-1-(4-methylphenyl)pyrazole |
|---|---|
| PubChem CID | 19587307 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3,5-bis(3-methoxyphenyl)-4-methyl-1-(4-methylphenyl)pyrazole |
| SMILES | COc1cccc(-c2nn(-c3ccc(C)cc3)c(-c3cccc(OC)c3)c2C)c1 |
| InChI | InChI=1S/C25H24N2O2/c1-17-11-13-21(14-12-17)27-25(20-8-6-10-23(16-20)29-4)18(2)24(26-27)19-7-5-9-22(15-19)28-3/h5-16H,1-4H3 |
| InChIKey | YFPFLTPOCNUQEF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |