C24H21ClN2O2 — CID 19587327
1-(4-chlorophenyl)-3,5-bis(3-methoxyphenyl)-4-methylpyrazole (PubChem CID 19587327) has the molecular formula C24H21ClN2O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3,5-bis(3-methoxyphenyl)-4-methylpyrazole.
| Compound Name | 1-(4-chlorophenyl)-3,5-bis(3-methoxyphenyl)-4-methylpyrazole |
|---|---|
| PubChem CID | 19587327 |
| Molecular Formula | C24H21ClN2O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3,5-bis(3-methoxyphenyl)-4-methylpyrazole |
| SMILES | COc1cccc(-c2nn(-c3ccc(Cl)cc3)c(-c3cccc(OC)c3)c2C)c1 |
| InChI | InChI=1S/C24H21ClN2O2/c1-16-23(17-6-4-8-21(14-17)28-2)26-27(20-12-10-19(25)11-13-20)24(16)18-7-5-9-22(15-18)29-3/h4-15H,1-3H3 |
| InChIKey | KXZCRIGJUYKJIJ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |