C30H20O — CID 158800989
hexadeca-2,4,6,8,10,12,14-heptayne;1-methoxy-3-(4-methylphenyl)benzene (PubChem CID 158800989) has the molecular formula C30H20O and a molecular weight of 396.49 g/mol. Its IUPAC name is hexadeca-2,4,6,8,10,12,14-heptayne;1-methoxy-3-(4-methylphenyl)benzene.
| Compound Name | hexadeca-2,4,6,8,10,12,14-heptayne;1-methoxy-3-(4-methylphenyl)benzene |
|---|---|
| PubChem CID | 158800989 |
| Molecular Formula | C30H20O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | hexadeca-2,4,6,8,10,12,14-heptayne;1-methoxy-3-(4-methylphenyl)benzene |
| SMILES | CC#CC#CC#CC#CC#CC#CC#CC.COc1cccc(-c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C16H6.C14H14O/c1-3-5-7-9-11-13-15-16-14-12-10-8-6-4-2;1-11-6-8-12(9-7-11)13-4-3-5-14(10-13)15-2/h1-2H3;3-10H,1-2H3 |
| InChIKey | ITMDRYNHJQSJMQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|