C26H15ClO — CID 158824739
1-chloro-3-(3-methoxyphenyl)benzene;trideca-1,3,5,7,9,11-hexayne (PubChem CID 158824739) has the molecular formula C26H15ClO and a molecular weight of 378.86 g/mol. Its IUPAC name is 1-chloro-3-(3-methoxyphenyl)benzene;trideca-1,3,5,7,9,11-hexayne.
| Compound Name | 1-chloro-3-(3-methoxyphenyl)benzene;trideca-1,3,5,7,9,11-hexayne |
|---|---|
| PubChem CID | 158824739 |
| Molecular Formula | C26H15ClO |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 1-chloro-3-(3-methoxyphenyl)benzene;trideca-1,3,5,7,9,11-hexayne |
| SMILES | C#CC#CC#CC#CC#CC#CC.COc1cccc(-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C13H11ClO.C13H4/c1-15-13-7-3-5-11(9-13)10-4-2-6-12(14)8-10;1-3-5-7-9-11-13-12-10-8-6-4-2/h2-9H,1H3;1H,2H3 |
| InChIKey | IWHXCJBUKUUAKG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|