C16H10FN3O3 — CID 94937536
1-(1,3-benzodioxol-5-yl)-5-(3-fluorophenyl)triazole-4-carbaldehyde (PubChem CID 94937536) has the molecular formula C16H10FN3O3 and a molecular weight of 311.27 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-5-(3-fluorophenyl)triazole-4-carbaldehyde.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-5-(3-fluorophenyl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 94937536 |
| Molecular Formula | C16H10FN3O3 |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-5-(3-fluorophenyl)triazole-4-carbaldehyde |
| SMILES | O=Cc1nnn(-c2ccc3c(c2)OCO3)c1-c1cccc(F)c1 |
| InChI | InChI=1S/C16H10FN3O3/c17-11-3-1-2-10(6-11)16-13(8-21)18-19-20(16)12-4-5-14-15(7-12)23-9-22-14/h1-8H,9H2 |
| InChIKey | VQVHYOLROVOFNV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|