C16H11N3O4 — CID 56768649
1-(1,3-benzodioxol-5-yl)-5-phenyltriazole-4-carboxylic acid (PubChem CID 56768649) has the molecular formula C16H11N3O4 and a molecular weight of 309.28 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-5-phenyltriazole-4-carboxylic acid.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-5-phenyltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 56768649 |
| Molecular Formula | C16H11N3O4 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-5-phenyltriazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(-c2ccc3c(c2)OCO3)c1-c1ccccc1 |
| InChI | InChI=1S/C16H11N3O4/c20-16(21)14-15(10-4-2-1-3-5-10)19(18-17-14)11-6-7-12-13(8-11)23-9-22-12/h1-8H,9H2,(H,20,21) |
| InChIKey | CLTNRBIAYFWQOU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |